ChemNet > CAS > 27464-82-0 2,5-Dimethyl-1,3,4-thiadiazole
27464-82-0 2,5-Dimethyl-1,3,4-thiadiazole
| اسم المنتج |
2,5-Dimethyl-1,3,4-thiadiazole |
| الاسم المستعار |
1,3,4-Thiadiazole, 2,5-dimethyl-; 2,5-Dimethylthiadiazole; NSC 93787 |
| الصيغة الجزيئية |
C4H6N2S |
| الوزن الجزيئي الغرامي |
114.1688 |
| InChI |
InChI=1/C4H6N2S/c1-3-5-6-4(2)7-3/h1-2H3 |
| إستراتيجية المساعدة القطرية |
27464-82-0 |
| المفوضية الأوروبية رقم |
248-473-4 |
| بنية جزيئية |
|
| كثافة |
1.166g/cm3 |
| درجة الإنصهار |
62-65℃ |
| نقطة الغليان |
202.5°C at 760 mmHg |
| معامل الإنكسار |
1.534 |
| نقطة الوميض |
81.2°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
