ChemNet > CAS > 29886-63-3 3-(2-thienyl)benzoic acid
29886-63-3 3-(2-thienyl)benzoic acid
| اسم المنتج |
3-(2-thienyl)benzoic acid |
| الاسم المستعار |
3-(thiophen-2-yl)benzoic acid; 3-thiophen-2-ylbenzoate |
| الصيغة الجزيئية |
C11H7O2S |
| الوزن الجزيئي الغرامي |
203.2376 |
| InChI |
InChI=1/C11H8O2S/c12-11(13)9-4-1-3-8(7-9)10-5-2-6-14-10/h1-7H,(H,12,13)/p-1 |
| إستراتيجية المساعدة القطرية |
29886-63-3 |
| بنية جزيئية |
|
| درجة الإنصهار |
166℃ |
| نقطة الغليان |
393.6°C at 760 mmHg |
| نقطة الوميض |
191.8°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
