ChemNet > CAS > 301699-39-8 (3,5-Dimethyl-4-methoxyphenyl)boronic acid
301699-39-8 (3,5-Dimethyl-4-methoxyphenyl)boronic acid
اسم المنتج |
(3,5-Dimethyl-4-methoxyphenyl)boronic acid |
الاسم المستعار |
4-Methoxy-3,5-dimethylbenzeneboronic acid; 3,5-Dimethyl-4-methoxybenzeneboronic acid~4-Methoxy-3,5-dimethylphenylboronic acid; (4-methoxy-3,5-dimethylphenyl)boronic acid |
الصيغة الجزيئية |
C9H13BO3 |
الوزن الجزيئي الغرامي |
180.0087 |
InChI |
InChI=1/C9H13BO3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5,11-12H,1-3H3 |
إستراتيجية المساعدة القطرية |
301699-39-8 |
بنية جزيئية |
|
كثافة |
1.11g/cm3 |
درجة الإنصهار |
235-242℃ |
نقطة الغليان |
335.8°C at 760 mmHg |
معامل الإنكسار |
1.517 |
نقطة الوميض |
156.9°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|