ChemNet > CAS > 3019-25-8 cyclobutyl methyl ketone
3019-25-8 cyclobutyl methyl ketone
| اسم المنتج |
cyclobutyl methyl ketone |
| الاسم المستعار |
Acetylcyclobutane; 1-cyclobutylethanone
; 1-cyclobutylethanone |
| الصيغة الجزيئية |
C6H10O |
| الوزن الجزيئي الغرامي |
98.143 |
| InChI |
InChI=1/C6H10O/c1-5(7)6-3-2-4-6/h6H,2-4H2,1H3 |
| إستراتيجية المساعدة القطرية |
3019-25-8 |
| المفوضية الأوروبية رقم |
221-163-6 |
| بنية جزيئية |
|
| كثافة |
0.96g/cm3 |
| نقطة الغليان |
137.5°C at 760 mmHg |
| معامل الإنكسار |
1.453 |
| نقطة الوميض |
32.3°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R10:Flammable.;
|
| شروط الأمن |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
