ChemNet > CAS > 312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile
312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile
اسم المنتج |
4-(Trifluoromethylsulfonyl)benzonitrile |
الاسم المستعار |
4-Cyanophenyl trifluoromethyl sulphone; 4-(Trifluoromethylsulphonyl)benzonitrile; 4-(Trifluoromethanesulfonyl)benzonitrile |
الصيغة الجزيئية |
C6H4FNO |
الوزن الجزيئي الغرامي |
125.1005 |
InChI |
InChI=1/C6H4FNO/c7-5-2-1-3-8-6(5)4-9/h1-4H |
إستراتيجية المساعدة القطرية |
312-21-0 |
بنية جزيئية |
|
كثافة |
1.269g/cm3 |
درجة الإنصهار |
84-88℃ |
نقطة الغليان |
166.5°C at 760 mmHg |
معامل الإنكسار |
1.543 |
نقطة الوميض |
54.5°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|