CAS No: 31364-42-8, Chemical Name: 4,7,13,16,21-pentaoxa-1,10-diazabicylco-(8.8.5)tricosane
the physical and chemical property of 31364-42-8, 4,7,13,16,21-pentaoxa-1,10-diazabicylco-(8.8.5)tricosane is provided by ChemNet.com
ChemNet > CAS > 31364-42-8 4,7,13,16,21-pentaoxa-1,10-diazabicylco-(8.8.5)tricosane
31364-42-8 4,7,13,16,21-pentaoxa-1,10-diazabicylco-(8.8.5)tricosane
اسم المنتج |
4,7,13,16,21-pentaoxa-1,10-diazabicylco-(8.8.5)tricosane |
الاسم المستعار |
4,7,13,16,21-Pentaoxa-1,10-diazabicyclo[8.8.5]tricosane; 4,7,13,16,21-pentaoxa-1,10-diazabicyclo(8.8.5)tr; 4,7,13,16,21-Pentaoxa-1,10-diaza(8,8,5)tricosane; Kryptofix 221; KRYPTOFIX(R) 221 |
الصيغة الجزيئية |
C16H32N2O5 |
الوزن الجزيئي الغرامي |
332.4357 |
InChI |
InChI=1/C16H32N2O5/c1-7-19-8-2-18-5-11-22-15-13-20-9-3-17(1)4-10-21-14-16-23-12-6-18/h1-16H2 |
إستراتيجية المساعدة القطرية |
31364-42-8 |
المفوضية الأوروبية رقم |
250-592-1 |
بنية جزيئية |
|
كثافة |
1.11g/cm3 |
نقطة الغليان |
465.4°C at 760 mmHg |
معامل الإنكسار |
1.505 |
نقطة الوميض |
133.7°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
|
|