ChemNet > CAS > 33070-32-5 5-bromo-2,2-difluorobenzodioxole
33070-32-5 5-bromo-2,2-difluorobenzodioxole
اسم المنتج |
5-bromo-2,2-difluorobenzodioxole |
الاسم المستعار |
4-Bromo-1,2-[(difluoromethylene)dioxy]benzene; 3,4-[(Difluoromethylene)dioxy]bromobenzene; 5-bromo-2,2-difluorobenzo[d][1,3]dioxole; 5-bromo-2,2-difluoro-1,3-benzodioxole; 4-fluoro-N-phenylaniline; 5-bromo-2,2-difluoro-2H-1,3-benzodioxole; 5-Bromo-2,2-difluoro-benz[1,3]dioxole |
الصيغة الجزيئية |
C12H10FN |
الوزن الجزيئي الغرامي |
187.2129 |
InChI |
InChI=1/C12H10FN/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,14H |
إستراتيجية المساعدة القطرية |
33070-32-5 |
بنية جزيئية |
|
كثافة |
1.172g/cm3 |
نقطة الغليان |
292.1°C at 760 mmHg |
معامل الإنكسار |
1.613 |
نقطة الوميض |
130.5°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|