ChemNet > CAS > 3319-99-1 2-(2-thienyl)pyridine
3319-99-1 2-(2-thienyl)pyridine
اسم المنتج |
2-(2-thienyl)pyridine |
الاسم المستعار |
2-(2-Pyridyl)thiophene; 2-(thiophen-2-yl)pyridine |
الصيغة الجزيئية |
C9H7NS |
الوزن الجزيئي الغرامي |
161.2236 |
InChI |
InChI=1/C9H7NS/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-7H |
إستراتيجية المساعدة القطرية |
3319-99-1 |
المفوضية الأوروبية رقم |
222-022-1 |
بنية جزيئية |
|
كثافة |
1.173g/cm3 |
نقطة الغليان |
268°C at 760 mmHg |
معامل الإنكسار |
1.604 |
نقطة الوميض |
115°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|