ChemNet > CAS > 3430-23-7 3,5-Dibromo-4-methylpyridine
3430-23-7 3,5-Dibromo-4-methylpyridine
| اسم المنتج |
3,5-Dibromo-4-methylpyridine |
| الاسم المستعار |
3,5-Dibromo-4-picoline |
| الصيغة الجزيئية |
C6H5Br2N |
| الوزن الجزيئي الغرامي |
250.9186 |
| InChI |
InChI=1/C6H5Br2N/c1-4-5(7)2-9-3-6(4)8/h2-3H,1H3 |
| إستراتيجية المساعدة القطرية |
3430-23-7 |
| بنية جزيئية |
|
| كثافة |
1.911g/cm3 |
| نقطة الغليان |
243°C at 760 mmHg |
| معامل الإنكسار |
1.593 |
| نقطة الوميض |
100.7°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
