ChemNet > CAS > 349-01-9 2,4-dinitro-5-fluorotoluene
349-01-9 2,4-dinitro-5-fluorotoluene
| اسم المنتج |
2,4-dinitro-5-fluorotoluene |
| الاسم المستعار |
1-Fluoro-5-methyl-2,4-dinitrobenzene |
| الصيغة الجزيئية |
C7H5FN2O4 |
| الوزن الجزيئي الغرامي |
200.124 |
| InChI |
InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
| إستراتيجية المساعدة القطرية |
349-01-9 |
| بنية جزيئية |
|
| كثافة |
1.497g/cm3 |
| درجة الإنصهار |
82℃ |
| نقطة الغليان |
319°C at 760 mmHg |
| معامل الإنكسار |
1.575 |
| نقطة الوميض |
146.8°C |
| علامات على البضائع الخطرة |
 T:Toxic;
|
| خطر المصطلحات |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
