ChemNet > CAS > 352018-91-8 1-(4-cyanophenyl)-4-piperidinecarbohydrazide
352018-91-8 1-(4-cyanophenyl)-4-piperidinecarbohydrazide
اسم المنتج |
1-(4-cyanophenyl)-4-piperidinecarbohydrazide |
الاسم المستعار |
1-(4-cyanophenyl)piperidine-4-carbohydrazide |
الصيغة الجزيئية |
C13H16N4O |
الوزن الجزيئي الغرامي |
244.2923 |
InChI |
InChI=1/C13H16N4O/c14-9-10-1-3-12(4-2-10)17-7-5-11(6-8-17)13(18)16-15/h1-4,11H,5-8,15H2,(H,16,18) |
إستراتيجية المساعدة القطرية |
352018-91-8 |
بنية جزيئية |
|
كثافة |
1.251g/cm3 |
نقطة الغليان |
528.975°C at 760 mmHg |
معامل الإنكسار |
1.617 |
نقطة الوميض |
273.715°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|