ChemNet > CAS > 35947-10-5 2-Methyl-1-(3-methylphenyl)piperazine
35947-10-5 2-Methyl-1-(3-methylphenyl)piperazine
اسم المنتج |
2-Methyl-1-(3-methylphenyl)piperazine |
الاسم المستعار |
2-Methyl-1-(m-tolyl)-piperazine; (3S)-3-methyl-4-(3-methylphenyl)piperazin-1-ium; (3R)-3-methyl-4-(3-methylphenyl)piperazin-1-ium |
الصيغة الجزيئية |
C12H19N2 |
الوزن الجزيئي الغرامي |
191.2921 |
InChI |
InChI=1/C12H18N2/c1-10-4-3-5-12(8-10)14-7-6-13-9-11(14)2/h3-5,8,11,13H,6-7,9H2,1-2H3/p+1/t11-/m1/s1 |
إستراتيجية المساعدة القطرية |
35947-10-5 |
المفوضية الأوروبية رقم |
252-810-0 |
بنية جزيئية |
|
نقطة الغليان |
326.9°C at 760 mmHg |
نقطة الوميض |
147.4°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|