CAS No: 36275-66-8, Chemical Name: 2,5-dichloro-3,6-dihydroxy-1,4-benzoquinone, disodium salt
the physical and chemical property of 36275-66-8, 2,5-dichloro-3,6-dihydroxy-1,4-benzoquinone, disodium salt is provided by ChemNet.com
ChemNet > CAS > 36275-66-8 2,5-dichloro-3,6-dihydroxy-1,4-benzoquinone, disodium salt
36275-66-8 2,5-dichloro-3,6-dihydroxy-1,4-benzoquinone, disodium salt
اسم المنتج |
2,5-dichloro-3,6-dihydroxy-1,4-benzoquinone, disodium salt |
الاسم المستعار |
2,5-Cyclohexadiene-1,4-dione, 2,5-dichloro-3,6-dihydroxy-, sodium salt (1:2); Chloranilic acid disodium salt; Disodium chloranilate; NSC 141076; 2,5-Cyclohexadiene-1,4-dione, 2,5-dichloro-3,6-dihydroxy-, disodium salt; 2,5-Cyclohexadiene-1,4-dione, 2,5-dichloro-3,6-dihydroxy-, disodium salt (9CI); 2,5-Dichloro-3,6-dihydroxy-1,4-benzoquinone, disodium salt; disodium 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate |
الصيغة الجزيئية |
C6Cl2Na2O4 |
الوزن الجزيئي الغرامي |
252.9473 |
InChI |
InChI=1/C6H2Cl2O4.2Na/c7-1-3(9)5(11)2(8)6(12)4(1)10;;/h9,12H;;/q;2*+1/p-2 |
إستراتيجية المساعدة القطرية |
36275-66-8 |
المفوضية الأوروبية رقم |
252-947-6 |
بنية جزيئية |
|
نقطة الغليان |
300.3°C at 760 mmHg |
نقطة الوميض |
135.4°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
|
|