ChemNet > CAS > 36401-55-5 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride
36401-55-5 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride
اسم المنتج |
5-methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride |
الصيغة الجزيئية |
C10H8ClN3O |
الوزن الجزيئي الغرامي |
221.643 |
InChI |
InChI=1/C10H8ClN3O/c1-7-9(10(11)15)13-14(12-7)8-5-3-2-4-6-8/h2-6H,1H3 |
إستراتيجية المساعدة القطرية |
36401-55-5 |
بنية جزيئية |
|
كثافة |
1.36g/cm3 |
درجة الإنصهار |
105℃ |
نقطة الغليان |
374.6°C at 760 mmHg |
معامل الإنكسار |
1.644 |
نقطة الوميض |
180.3°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|