ChemNet > CAS > 38464-20-9 4-Chloro-3-nitrocoumarin
38464-20-9 4-Chloro-3-nitrocoumarin
اسم المنتج |
4-Chloro-3-nitrocoumarin |
الاسم المستعار |
4-chloro-3-nitro-2H-chromen-2-one |
الصيغة الجزيئية |
C9H4ClNO4 |
الوزن الجزيئي الغرامي |
225.5854 |
InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
إستراتيجية المساعدة القطرية |
38464-20-9 |
بنية جزيئية |
|
كثافة |
1.6g/cm3 |
درجة الإنصهار |
160-164℃ |
نقطة الغليان |
338.7°C at 760 mmHg |
معامل الإنكسار |
1.642 |
نقطة الوميض |
158.6°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|