ChemNet > CAS > 392-04-1 Methyl 4-fluoro-2-hydroxybenzoate
392-04-1 Methyl 4-fluoro-2-hydroxybenzoate
اسم المنتج |
Methyl 4-fluoro-2-hydroxybenzoate |
الاسم المستعار |
Methyl 4-fluorosalicylate; 4-Fluorosalicylic acid methyl ester; Methyl 4-fluoro-2-hydroxybenzoate; 4-Fluoro-6-hydroxy-benzoic acid methyl ester |
الصيغة الجزيئية |
C8H7FO3 |
الوزن الجزيئي الغرامي |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-8(11)6-3-2-5(9)4-7(6)10/h2-4,10H,1H3 |
إستراتيجية المساعدة القطرية |
392-04-1 |
بنية جزيئية |
|
كثافة |
1.309g/cm3 |
نقطة الغليان |
224.7°C at 760 mmHg |
معامل الإنكسار |
1.526 |
نقطة الوميض |
89.7°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|