ChemNet > CAS > 39565-00-9 2-Acetyl-5-nitrothiophene
39565-00-9 2-Acetyl-5-nitrothiophene
اسم المنتج |
2-Acetyl-5-nitrothiophene |
الاسم المستعار |
5-Nitro-2-thienyl methyl ketone; Methyl 5-nitro-2-thienyl ketone; 1-(5-nitrothiophen-2-yl)ethanone |
الصيغة الجزيئية |
C6H5NO3S |
الوزن الجزيئي الغرامي |
171.1738 |
InChI |
InChI=1/C6H5NO3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3 |
إستراتيجية المساعدة القطرية |
39565-00-9 |
بنية جزيئية |
|
كثافة |
1.399g/cm3 |
نقطة الغليان |
268.9°C at 760 mmHg |
معامل الإنكسار |
1.589 |
نقطة الوميض |
116.4°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|