CAS No: 3999-42-6, Chemical Name: borane-2,6-lutidine complex

the physical and chemical property of 3999-42-6, borane-2,6-lutidine complex is provided by ChemNet.com

ChemNet > CAS > 3999-42-6 borane-2,6-lutidine complex

3999-42-6 borane-2,6-lutidine complex

اسم المنتج	borane-2,6-lutidine complex
الاسم المستعار	2,6-dimethylpyridine-borane
الصيغة الجزيئية	C₇H₁₂BN
الوزن الجزيئي الغرامي	120.98
InChI	InChI=1/C7H12BN/c1-6-4-3-5-7(2)9(6)8/h3-5H,1-2,8H3/q+1
إستراتيجية المساعدة القطرية	3999-42-6
المفوضية الأوروبية رقم	223-645-1
بنية جزيئية
علامات على البضائع الخطرة
خطر المصطلحات
شروط الأمن