ChemNet > CAS > 403-15-6 4-Fluoro-3-methylbenzoic acid
403-15-6 4-Fluoro-3-methylbenzoic acid
اسم المنتج |
4-Fluoro-3-methylbenzoic acid |
الاسم المستعار |
4-Fluoro-m-toluic acid; 4-fluoro-3-methylbenzoate; 3-methyl-4-Fluorobenzoic acid;
|
الصيغة الجزيئية |
C8H6FO2 |
الوزن الجزيئي الغرامي |
153.131 |
InChI |
InChI=1/C8H7FO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11)/p-1 |
إستراتيجية المساعدة القطرية |
403-15-6 |
بنية جزيئية |
|
درجة الإنصهار |
166-169℃ |
نقطة الغليان |
266.3°C at 760 mmHg |
نقطة الوميض |
114.9°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|