ChemNet > CAS > 40477-45-0 3,4-Dibromo-2,5-dichlorothiophene
40477-45-0 3,4-Dibromo-2,5-dichlorothiophene
| اسم المنتج |
3,4-Dibromo-2,5-dichlorothiophene |
| الصيغة الجزيئية |
C4Br2Cl2S |
| الوزن الجزيئي الغرامي |
310.8218 |
| InChI |
InChI=1/C4Br2Cl2S/c5-1-2(6)4(8)9-3(1)7 |
| إستراتيجية المساعدة القطرية |
40477-45-0 |
| بنية جزيئية |
|
| كثافة |
2.299g/cm3 |
| نقطة الغليان |
284.1°C at 760 mmHg |
| معامل الإنكسار |
1.658 |
| نقطة الوميض |
125.6°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
