ChemNet > CAS > 41927-01-9 3,4-Dimethyl-o-phenylenediamine
41927-01-9 3,4-Dimethyl-o-phenylenediamine
اسم المنتج |
3,4-Dimethyl-o-phenylenediamine |
الاسم المستعار |
3,4-Diamino-o-xylene = 3,4-Dimethylphenylenediamine; 3,4-dimethylbenzene-1,2-diamine |
الصيغة الجزيئية |
C8H12N2 |
الوزن الجزيئي الغرامي |
136.1943 |
InChI |
InChI=1/C8H12N2/c1-5-3-4-7(9)8(10)6(5)2/h3-4H,9-10H2,1-2H3 |
إستراتيجية المساعدة القطرية |
41927-01-9 |
بنية جزيئية |
|
كثافة |
1.076g/cm3 |
نقطة الغليان |
278.3°C at 760 mmHg |
معامل الإنكسار |
1.618 |
نقطة الوميض |
143.9°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|