ChemNet > CAS > 4347-31-3 2-Formylthiophene-3-boronic acid
4347-31-3 2-Formylthiophene-3-boronic acid
اسم المنتج |
2-Formylthiophene-3-boronic acid |
الاسم المستعار |
3-Boronothiophene-2-carboxaldehyde; (2-Formyl-3-thienyl)boronic acid; (2-formylthiophen-3-yl)boronic acid |
الصيغة الجزيئية |
C5H5BO3S |
الوزن الجزيئي الغرامي |
155.9674 |
InChI |
InChI=1/C5H5BO3S/c7-3-5-4(6(8)9)1-2-10-5/h1-3,8-9H |
إستراتيجية المساعدة القطرية |
4347-31-3 |
بنية جزيئية |
|
كثافة |
1.41g/cm3 |
درجة الإنصهار |
167-173℃ |
نقطة الغليان |
396.7°C at 760 mmHg |
معامل الإنكسار |
1.573 |
نقطة الوميض |
193.7°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|