ChemNet > CAS > 4395-87-3 4-Isopropylphenylacetonitrile
4395-87-3 4-Isopropylphenylacetonitrile
اسم المنتج |
4-Isopropylphenylacetonitrile |
الاسم المستعار |
[4-(propan-2-yl)phenyl]acetonitrile |
الصيغة الجزيئية |
C11H13N |
الوزن الجزيئي الغرامي |
159.2276 |
InChI |
InChI=1/C11H13N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7H2,1-2H3 |
إستراتيجية المساعدة القطرية |
4395-87-3 |
بنية جزيئية |
|
كثافة |
0.96g/cm3 |
نقطة الغليان |
261.1°C at 760 mmHg |
معامل الإنكسار |
1.514 |
نقطة الوميض |
117.5°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|