ChemNet > CAS > 4491-92-3 1-(2-Cyanoethyl)-4-methylpiperazine
4491-92-3 1-(2-Cyanoethyl)-4-methylpiperazine
اسم المنتج |
1-(2-Cyanoethyl)-4-methylpiperazine |
الاسم المستعار |
3-(4-Methylpiperazino)propionitrile; 3-(4-methylpiperazin-1-yl)propanenitrile |
الصيغة الجزيئية |
C8H15N3 |
الوزن الجزيئي الغرامي |
153.2248 |
InChI |
InChI=1/C8H15N3/c1-10-5-7-11(8-6-10)4-2-3-9/h2,4-8H2,1H3 |
إستراتيجية المساعدة القطرية |
4491-92-3 |
بنية جزيئية |
|
كثافة |
0.981g/cm3 |
نقطة الغليان |
273°C at 760 mmHg |
معامل الإنكسار |
1.477 |
نقطة الوميض |
113.6°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|