ChemNet > CAS > 4511-42-6 L-Lactide S
4511-42-6 L-Lactide S
اسم المنتج |
L-Lactide S |
الاسم المستعار |
(3S)-cis-3,6-Dimethyl-1,4-dioxane-2,5-dione; Lactide; L-Lactide; (3S)-Cis-3,6-dimethyl-1,4-dioxane-2,5-dione; (S,S)-3,6-Dimethyl-1,4-dioxane-2,5-dione; L-Lactide; 3,6-dimethyl-1,4-dioxane-2,5-dione; (3R,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione; L-(-)-Lactide |
الصيغة الجزيئية |
C6H8O4 |
الوزن الجزيئي الغرامي |
144.1253 |
InChI |
InChI=1/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3/t3-,4+ |
إستراتيجية المساعدة القطرية |
4511-42-6 |
المفوضية الأوروبية رقم |
224-832-0 |
بنية جزيئية |
|
كثافة |
1.186g/cm3 |
درجة الإنصهار |
92-98℃ |
نقطة الغليان |
285.5°C at 760 mmHg |
معامل الإنكسار |
1.429 |
نقطة الوميض |
150.6°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37:Irritating to eyes and respiratory system.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|