ChemNet > CAS > 458-05-9 1-(3-fluorophenyl)-2-thiourea
458-05-9 1-(3-fluorophenyl)-2-thiourea
اسم المنتج |
1-(3-fluorophenyl)-2-thiourea |
الاسم المستعار |
3-Fluorophenylthiourea; 1-(3-fluorophenyl)thiourea |
الصيغة الجزيئية |
C7H7FN2S |
الوزن الجزيئي الغرامي |
170.2073 |
InChI |
InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
إستراتيجية المساعدة القطرية |
458-05-9 |
بنية جزيئية |
|
كثافة |
1.397g/cm3 |
نقطة الغليان |
259.3°C at 760 mmHg |
معامل الإنكسار |
1.692 |
نقطة الوميض |
110.6°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R25:Toxic if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|