ChemNet > CAS > 4640-68-0 3,4-Dichlorobenzoylacetonitrile
4640-68-0 3,4-Dichlorobenzoylacetonitrile
| اسم المنتج |
3,4-Dichlorobenzoylacetonitrile |
| الاسم المستعار |
3-(3,4-dichlorophenyl)-3-oxopropanenitrile |
| الصيغة الجزيئية |
C9H5Cl2NO |
| الوزن الجزيئي الغرامي |
214.0481 |
| InChI |
InChI=1/C9H5Cl2NO/c10-7-2-1-6(5-8(7)11)9(13)3-4-12/h1-2,5H,3H2 |
| إستراتيجية المساعدة القطرية |
4640-68-0 |
| بنية جزيئية |
|
| كثافة |
1.383g/cm3 |
| نقطة الغليان |
398.4°C at 760 mmHg |
| معامل الإنكسار |
1.567 |
| نقطة الوميض |
194.7°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
