ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
| اسم المنتج |
2-aminothiophene-3-carbonitrile |
| الاسم المستعار |
2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
| الصيغة الجزيئية |
C5H4N2S |
| الوزن الجزيئي الغرامي |
124.1637 |
| InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
| إستراتيجية المساعدة القطرية |
4651-82-5 |
| بنية جزيئية |
|
| كثافة |
1.33g/cm3 |
| درجة الإنصهار |
104℃ |
| نقطة الغليان |
317.5°C at 760 mmHg |
| معامل الإنكسار |
1.627 |
| نقطة الوميض |
145.8°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|
