ChemNet > CAS > 4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
اسم المنتج |
Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate |
الاسم المستعار |
5-Amino-3-methyl-2,4-thiophenedicarboxilic acid diethyl ester; diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate |
الصيغة الجزيئية |
C11H15NO4S |
الوزن الجزيئي الغرامي |
257.3061 |
InChI |
InChI=1/C11H15NO4S/c1-4-15-10(13)7-6(3)8(17-9(7)12)11(14)16-5-2/h4-5,12H2,1-3H3 |
إستراتيجية المساعدة القطرية |
4815-30-9 |
المفوضية الأوروبية رقم |
225-388-0 |
بنية جزيئية |
|
كثافة |
1.247g/cm3 |
درجة الإنصهار |
103-108℃ |
نقطة الغليان |
372.6°C at 760 mmHg |
معامل الإنكسار |
1.558 |
نقطة الوميض |
179.1°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|