ChemNet > CAS > 4845-50-5 trans-2,3-dihydroxy-1,4-dioxane
4845-50-5 trans-2,3-dihydroxy-1,4-dioxane
اسم المنتج |
trans-2,3-dihydroxy-1,4-dioxane |
الاسم المستعار |
2,3-Dihydroxy-1,4-dioxane; Glyoxal monoethylene acetal; Dioxanediol; 1,4-dioxane-2,3-diol; trans-1,4-Dioxane-2,3-diol |
الصيغة الجزيئية |
C4H8O4 |
الوزن الجزيئي الغرامي |
120.1039 |
InChI |
InChI=1/C4H8O4/c5-3-4(6)8-2-1-7-3/h3-6H,1-2H2 |
إستراتيجية المساعدة القطرية |
4845-50-5 |
المفوضية الأوروبية رقم |
225-431-3 |
بنية جزيئية |
|
كثافة |
1.455g/cm3 |
درجة الإنصهار |
91-95℃ |
نقطة الغليان |
259.4°C at 760 mmHg |
معامل الإنكسار |
1.513 |
نقطة الوميض |
110.7°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36:Irritating to eyes.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|