ChemNet > CAS > 499770-63-7 (1,3-Dimethyl-1H-pyrazol-5-yl)methylamine
499770-63-7 (1,3-Dimethyl-1H-pyrazol-5-yl)methylamine
اسم المنتج |
(1,3-Dimethyl-1H-pyrazol-5-yl)methylamine |
الاسم المستعار |
1-(1,3-dimethyl-1H-pyrazol-5-yl)methanamine; (1,3-dimethyl-1H-pyrazol-5-yl)methanamine |
الصيغة الجزيئية |
C6H11N3 |
الوزن الجزيئي الغرامي |
125.1716 |
InChI |
InChI=1/C6H11N3/c1-5-3-6(4-7)9(2)8-5/h3H,4,7H2,1-2H3 |
إستراتيجية المساعدة القطرية |
499770-63-7 |
بنية جزيئية |
|
كثافة |
1.12g/cm3 |
نقطة الغليان |
229.3°C at 760 mmHg |
معامل الإنكسار |
1.566 |
نقطة الوميض |
92.5°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|