ChemNet > CAS > 50382-32-6 (2,4-dimethyl-1,3-thiazol-5-yl)methanol
50382-32-6 (2,4-dimethyl-1,3-thiazol-5-yl)methanol
| اسم المنتج |
(2,4-dimethyl-1,3-thiazol-5-yl)methanol |
| الاسم المستعار |
(2,4-dimethylthiazol-5-yl)methanol;
|
| الصيغة الجزيئية |
C6H9NOS |
| الوزن الجزيئي الغرامي |
143.2068 |
| InChI |
InChI=1/C6H9NOS/c1-4-6(3-8)9-5(2)7-4/h8H,3H2,1-2H3 |
| إستراتيجية المساعدة القطرية |
50382-32-6 |
| بنية جزيئية |
|
| كثافة |
1.208g/cm3 |
| درجة الإنصهار |
46℃ |
| نقطة الغليان |
261.965°C at 760 mmHg |
| معامل الإنكسار |
1.569 |
| نقطة الوميض |
112.233°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
