ChemNet > CAS > 51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
اسم المنتج |
5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
الصيغة الجزيئية |
C10H7ClN4 |
الوزن الجزيئي الغرامي |
218.6424 |
InChI |
InChI=1/C10H7ClN4/c11-8-1-3-9(4-2-8)15-10(13)7(5-12)6-14-15/h1-4,6H,13H2 |
إستراتيجية المساعدة القطرية |
51516-67-7 |
بنية جزيئية |
|
كثافة |
1.41g/cm3 |
درجة الإنصهار |
170℃ |
نقطة الغليان |
424.2°C at 760 mmHg |
معامل الإنكسار |
1.686 |
نقطة الوميض |
210.4°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|