ChemNet > CAS > 51787-96-3 Gamma-(4-Fluorophenyl)-Gamma-butyrolactone
51787-96-3 Gamma-(4-Fluorophenyl)-Gamma-butyrolactone
اسم المنتج |
Gamma-(4-Fluorophenyl)-Gamma-butyrolactone |
الاسم المستعار |
5-(4-Fluorophenyl)-dihydro-2(3H)-furanone; 4,5-Dihydro-5-(4-fluorophenyl)-2(3H)-furanone; 4-(4-Fluorobenzoyl)Butyrol Acetone; 5-(4-fluorophenyl)dihydrofuran-2(3H)-one; (5R)-5-(4-fluorophenyl)dihydrofuran-2(3H)-one; (5S)-5-(4-fluorophenyl)dihydrofuran-2(3H)-one |
الصيغة الجزيئية |
C10H9FO2 |
الوزن الجزيئي الغرامي |
180.1757 |
InChI |
InChI=1/C10H9FO2/c11-8-3-1-7(2-4-8)9-5-6-10(12)13-9/h1-4,9H,5-6H2/t9-/m0/s1 |
إستراتيجية المساعدة القطرية |
51787-96-3 |
المفوضية الأوروبية رقم |
257-422-5 |
بنية جزيئية |
|
كثافة |
1.245g/cm3 |
نقطة الغليان |
324.5°C at 760 mmHg |
معامل الإنكسار |
1.529 |
نقطة الوميض |
145.1°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|