ChemNet > CAS > 52516-13-9 2,4-Dichlorophenethylamine
52516-13-9 2,4-Dichlorophenethylamine
| اسم المنتج |
2,4-Dichlorophenethylamine |
| الاسم المستعار |
2-(2,4-Dichlorophenyl)-ethylamine; 2-(2,4-dichlorophenyl)ethanamine; 2-(2,4-dichlorophenyl)ethanaminium; 2,4-Dichloro-benzeneethanamine |
| الصيغة الجزيئية |
C8H9Cl2N |
| الوزن الجزيئي الغرامي |
190.0698 |
| InChI |
InChI=1/C8H9Cl2N/c1-5(11)7-3-2-6(9)4-8(7)10/h2-5H,11H2,1H3 |
| إستراتيجية المساعدة القطرية |
52516-13-9 |
| بنية جزيئية |
|
| كثافة |
1.262g/cm3 |
| نقطة الغليان |
256.4°C at 760 mmHg |
| معامل الإنكسار |
1.566 |
| نقطة الوميض |
108.8°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
