ChemNet > CAS > 527-31-1 Hexaketocyclohexane octahydrate
527-31-1 Hexaketocyclohexane octahydrate
| اسم المنتج |
Hexaketocyclohexane octahydrate |
| الاسم المستعار |
cyclohexanehexaone; Trquinoylhydrate; Hexaoxocyclohexane octahydrate; Triquinolyl octahydrate; Cyclohexanehexone; Trquinoyl; cyclohexane-1,2,3,4,5,6-hexone; cyclohexane-1,2,3,4,5,6-hexone octahydrate; cyclohexane-1,2,3,4,5,6-hexaone Octahydrate |
| الصيغة الجزيئية |
C6H16O14 |
| الوزن الجزيئي الغرامي |
312.1828 |
| InChI |
InChI=1/C6O6.8H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;;;;;;/h;8*1H2 |
| إستراتيجية المساعدة القطرية |
527-31-1 |
| المفوضية الأوروبية رقم |
208-412-4 |
| بنية جزيئية |
|
| درجة الإنصهار |
90-93℃ |
| نقطة الغليان |
344.7°C at 760 mmHg |
| نقطة الوميض |
152°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21:Harmful by inhalation and in contact with skin.;
|
| شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
