ChemNet > CAS > 53293-00-8 5-Hexynoic acid
53293-00-8 5-Hexynoic acid
| اسم المنتج |
5-Hexynoic acid |
| الاسم المستعار |
Hex-5-ynoic acid; hex-5-ynoate |
| الصيغة الجزيئية |
C6H7O2 |
| الوزن الجزيئي الغرامي |
111.1191 |
| InChI |
InChI=1/C6H8O2/c1-2-3-4-5-6(7)8/h1H,3-5H2,(H,7,8)/p-1 |
| إستراتيجية المساعدة القطرية |
53293-00-8 |
| بنية جزيئية |
|
| نقطة الغليان |
220.6°C at 760 mmHg |
| نقطة الوميض |
99.6°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R34:Causes burns.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
