ChemNet > CAS > 5391-30-0 2-Bromophenylthiourea
5391-30-0 2-Bromophenylthiourea
| اسم المنتج |
2-Bromophenylthiourea |
| الاسم المستعار |
Thiourea, (2-bromophenyl)-; 1-(2-bromophenyl)thiourea |
| الصيغة الجزيئية |
C7H7BrN2S |
| الوزن الجزيئي الغرامي |
231.1129 |
| InChI |
InChI=1/C7H7BrN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
| إستراتيجية المساعدة القطرية |
5391-30-0 |
| بنية جزيئية |
|
| كثافة |
1.728g/cm3 |
| نقطة الغليان |
314.2°C at 760 mmHg |
| معامل الإنكسار |
1.748 |
| نقطة الوميض |
143.8°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R25:Toxic if swallowed.;
|
| شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
