ChemNet > CAS > 53941-45-0 2-Phenylglycinonitrile hydrochloride
53941-45-0 2-Phenylglycinonitrile hydrochloride
| اسم المنتج |
2-Phenylglycinonitrile hydrochloride |
| الاسم المستعار |
alpha-Aminobenzyl cyanide hydrochloride~alpha-Aminophenylacetonitrile hydrochloride; (S)-cyano(phenyl)methanaminium; (R)-cyano(phenyl)methanaminium |
| الصيغة الجزيئية |
C8H9N2 |
| الوزن الجزيئي الغرامي |
133.1699 |
| InChI |
InChI=1/C8H8N2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8H,10H2/p+1/t8-/m0/s1 |
| إستراتيجية المساعدة القطرية |
53941-45-0 |
| بنية جزيئية |
|
| درجة الإنصهار |
158-165℃ |
| نقطة الغليان |
235.8°C at 760 mmHg |
| نقطة الوميض |
96.4°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|
