ChemNet > CAS > 5585-33-1 2-(4-Morpholino)aniline
5585-33-1 2-(4-Morpholino)aniline
| اسم المنتج |
2-(4-Morpholino)aniline |
| الاسم المستعار |
4-(2-Aminophenyl)morpholine; 2-(morpholin-4-yl)aniline; 2-morpholinoaniline |
| الصيغة الجزيئية |
C10H14N2O |
| الوزن الجزيئي الغرامي |
178.231 |
| InChI |
InChI=1/C10H14N2O/c11-9-3-1-2-4-10(9)12-5-7-13-8-6-12/h1-4H,5-8,11H2 |
| إستراتيجية المساعدة القطرية |
5585-33-1 |
| بنية جزيئية |
|
| كثافة |
1.149g/cm3 |
| درجة الإنصهار |
93℃ |
| نقطة الغليان |
332.5°C at 760 mmHg |
| معامل الإنكسار |
1.589 |
| نقطة الوميض |
154.9°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
