ChemNet > CAS > 56041-57-7 2,3-Dichloroacetophenone
56041-57-7 2,3-Dichloroacetophenone
اسم المنتج |
2,3-Dichloroacetophenone |
الاسم المستعار |
1-(2,3-Dichlorophenyl)ethan-1-one; 1-(2,3-dichlorophenyl)ethanone |
الصيغة الجزيئية |
C8H6Cl2O |
الوزن الجزيئي الغرامي |
189.0386 |
InChI |
InChI=1/C8H6Cl2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
إستراتيجية المساعدة القطرية |
56041-57-7 |
المفوضية الأوروبية رقم |
259-954-3 |
بنية جزيئية |
|
كثافة |
1.304g/cm3 |
درجة الإنصهار |
106℃ |
نقطة الغليان |
247.3°C at 760 mmHg |
معامل الإنكسار |
1.548 |
نقطة الوميض |
101.3°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|