ChemNet > CAS > 573-03-5 4-fluoro-1-naphthoic acid
573-03-5 4-fluoro-1-naphthoic acid
| اسم المنتج |
4-fluoro-1-naphthoic acid |
| الاسم المستعار |
4-Fluoro-1-naphthoic acid; 4-fluoronaphthalene-1-carboxylic acid; 4-fluoronaphthalene-1-carboxylate; 4-Fluoro-1-naphthoicacid |
| الصيغة الجزيئية |
C11H6FO2 |
| الوزن الجزيئي الغرامي |
189.1631 |
| InChI |
InChI=1/C11H7FO2/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6H,(H,13,14)/p-1 |
| إستراتيجية المساعدة القطرية |
573-03-5 |
| المفوضية الأوروبية رقم |
209-346-9 |
| بنية جزيئية |
|
| درجة الإنصهار |
223-227℃ |
| نقطة الغليان |
370.8°C at 760 mmHg |
| نقطة الوميض |
178°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
