ChemNet > CAS > 588-43-2 tributyl orthoformate
588-43-2 tributyl orthoformate
اسم المنتج |
tributyl orthoformate |
الاسم المستعار |
1-(Dibutoxymethoxy)butane; 1,1',1''-(Methylidynetris(oxy))tributane; Butane, 1,1',1''-(methylidynetris(oxy))tris-; butane, 1,1',1''-[methylidynetris(oxy)]tris-; Orthoformic acid, tributyl ester; Orthoformic acid, tributyl ester (8CI) |
الصيغة الجزيئية |
C13H28O3 |
الوزن الجزيئي الغرامي |
232.3596 |
InChI |
InChI=1/C13H28O3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h13H,4-12H2,1-3H3 |
إستراتيجية المساعدة القطرية |
588-43-2 |
المفوضية الأوروبية رقم |
209-618-7 |
بنية جزيئية |
|
كثافة |
0.884g/cm3 |
نقطة الغليان |
262.7°C at 760 mmHg |
معامل الإنكسار |
1.427 |
نقطة الوميض |
96.3°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|