ChemNet > CAS > 58805-52-0 1-(5-acetyl-2,4-dihydroxy-3-propylphenyl)ethan-1-one
58805-52-0 1-(5-acetyl-2,4-dihydroxy-3-propylphenyl)ethan-1-one
اسم المنتج |
1-(5-acetyl-2,4-dihydroxy-3-propylphenyl)ethan-1-one |
الاسم المستعار |
1,1'-(4,6-dihydroxy-5-propylbenzene-1,3-diyl)diethanone |
الصيغة الجزيئية |
C13H16O4 |
الوزن الجزيئي الغرامي |
236.2637 |
InChI |
InChI=1/C13H16O4/c1-4-5-9-12(16)10(7(2)14)6-11(8(3)15)13(9)17/h6,16-17H,4-5H2,1-3H3 |
إستراتيجية المساعدة القطرية |
58805-52-0 |
بنية جزيئية |
|
كثافة |
1.189g/cm3 |
درجة الإنصهار |
99℃ |
نقطة الغليان |
434.2°C at 760 mmHg |
معامل الإنكسار |
1.56 |
نقطة الوميض |
230.5°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|