ChemNet > CAS > 59108-13-3 5,7-dichloro-4-hydroxy-2-(trifluoromethyl)quinoline
59108-13-3 5,7-dichloro-4-hydroxy-2-(trifluoromethyl)quinoline
اسم المنتج |
5,7-dichloro-4-hydroxy-2-(trifluoromethyl)quinoline |
الاسم المستعار |
5,7-Dichloro-2-(trifluoromethyl)quinolin-4-ol; 5,7-dichloro-2-(trifluoromethyl)quinolin-4(1H)-one |
الصيغة الجزيئية |
C7H4BrFO |
الوزن الجزيئي الغرامي |
203.0085 |
InChI |
InChI=1/C7H4BrFO/c8-7-3-6(9)2-1-5(7)4-10/h1-4H |
إستراتيجية المساعدة القطرية |
59108-13-3 |
بنية جزيئية |
|
كثافة |
1.67g/cm3 |
درجة الإنصهار |
230℃ |
نقطة الغليان |
234.9°C at 760 mmHg |
معامل الإنكسار |
1.584 |
نقطة الوميض |
95.9°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|