ChemNet > CAS > 601-79-6 Isopropylmalonic acid
601-79-6 Isopropylmalonic acid
اسم المنتج |
Isopropylmalonic acid |
الاسم المستعار |
isopropyl malonic acid; propan-2-ylpropanedioic acid; (1-methylethyl)propanedioate |
الصيغة الجزيئية |
C6H8O4 |
الوزن الجزيئي الغرامي |
144.1264 |
InChI |
InChI=1/C6H10O4/c1-3(2)4(5(7)8)6(9)10/h3-4H,1-2H3,(H,7,8)(H,9,10)/p-2 |
إستراتيجية المساعدة القطرية |
601-79-6 |
المفوضية الأوروبية رقم |
210-008-8 |
بنية جزيئية |
|
نقطة الغليان |
315.4°C at 760 mmHg |
نقطة الوميض |
158.7°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|