ChemNet > CAS > 61040-81-1 3,5-Dimethoxy-4-methylbenzoic acid
61040-81-1 3,5-Dimethoxy-4-methylbenzoic acid
اسم المنتج |
3,5-Dimethoxy-4-methylbenzoic acid |
الاسم المستعار |
3,5-Dimethoxy-p-toluic acid (COOH=1) |
الصيغة الجزيئية |
C10H12O4 |
الوزن الجزيئي الغرامي |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-6-8(13-2)4-7(10(11)12)5-9(6)14-3/h4-5H,1-3H3,(H,11,12) |
إستراتيجية المساعدة القطرية |
61040-81-1 |
بنية جزيئية |
|
كثافة |
1.18g/cm3 |
درجة الإنصهار |
211-216℃ |
نقطة الغليان |
347.7°C at 760 mmHg |
معامل الإنكسار |
1.53 |
نقطة الوميض |
137.8°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|