ChemNet > CAS > 61341-26-2 3-Methylthiophene-2-carbonyl chloride
61341-26-2 3-Methylthiophene-2-carbonyl chloride
اسم المنتج |
3-Methylthiophene-2-carbonyl chloride |
الاسم المستعار |
2-thiophenecarbonyl chloride, 3-methyl-; 3-METHYLTHIOPHENE-2-CARBONYL CHLORIDE |
الصيغة الجزيئية |
C6H5ClOS |
الوزن الجزيئي الغرامي |
160.6213 |
InChI |
InChI=1/C6H5ClOS/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3 |
إستراتيجية المساعدة القطرية |
61341-26-2 |
بنية جزيئية |
|
كثافة |
1.32g/cm3 |
نقطة الغليان |
219.9°C at 760 mmHg |
معامل الإنكسار |
1.566 |
نقطة الوميض |
86.8°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|