ChemNet > CAS > 614-10-8 4-(2-Methylphenyl)-3-thiosemicarbazide
614-10-8 4-(2-Methylphenyl)-3-thiosemicarbazide
اسم المنتج |
4-(2-Methylphenyl)-3-thiosemicarbazide |
الاسم المستعار |
4-(o-Tolyl)-3-thiosemicarbazide; N-(2-methylphenyl)hydrazinecarbothioamide; 2-(2-methylphenyl)hydrazinecarbothioamide |
الصيغة الجزيئية |
C8H11N3S |
الوزن الجزيئي الغرامي |
181.258 |
InChI |
InChI=1/C8H11N3S/c1-6-4-2-3-5-7(6)10-11-8(9)12/h2-5,10H,1H3,(H3,9,11,12) |
إستراتيجية المساعدة القطرية |
614-10-8 |
بنية جزيئية |
|
كثافة |
1.27g/cm3 |
نقطة الغليان |
295.9°C at 760 mmHg |
معامل الإنكسار |
1.699 |
نقطة الوميض |
132.8°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R25:Toxic if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|