ChemNet > CAS > 620-88-2 4-Nitrophenyl phenyl ether
620-88-2 4-Nitrophenyl phenyl ether
| اسم المنتج |
4-Nitrophenyl phenyl ether |
| الاسم المستعار |
p-Nitrodiphenyl ether; P-NITRODIPHENYLETHER; 1-nitro-4-phenoxybenzene; methyl 2-[(chloroacetyl)amino]benzoate; 2-chloro-N-(2-fluorophenyl)acetamide; 2-chloro-1-[2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrol-3-yl]ethanone |
| الصيغة الجزيئية |
C15H16ClNO |
| الوزن الجزيئي الغرامي |
261.7466 |
| InChI |
InChI=1/C15H16ClNO/c1-10-4-6-13(7-5-10)17-11(2)8-14(12(17)3)15(18)9-16/h4-8H,9H2,1-3H3 |
| إستراتيجية المساعدة القطرية |
620-88-2 |
| المفوضية الأوروبية رقم |
210-656-1 |
| بنية جزيئية |
|
| كثافة |
1.12g/cm3 |
| درجة الإنصهار |
53-56℃ |
| نقطة الغليان |
399.6°C at 760 mmHg |
| معامل الإنكسار |
1.564 |
| نقطة الوميض |
195.4°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|
